C17H19N3S — CID 68530802
2-[(3R)-3-methyl-4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 68530802) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[(3R)-3-methyl-4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[(3R)-3-methyl-4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 68530802 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 2-[(3R)-3-methyl-4-(3-phenylprop-2-ynyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | C[C@@H]1CN(c2nccs2)CCN1CC#Cc1ccccc1 |
| InChI | InChI=1S/C17H19N3S/c1-15-14-20(17-18-9-13-21-17)12-11-19(15)10-5-8-16-6-3-2-4-7-16/h2-4,6-7,9,13,15H,10-12,14H2,1H3/t15-/m1/s1 |
| InChIKey | SEHMCEFOFQPAND-OAHLLOKOSA-N |
| XLogP | 2.71 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|