C22H17FO4S — CID 68532913
2-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]sulfonyl-3-methylbenzoic acid (PubChem CID 68532913) has the molecular formula C22H17FO4S and a molecular weight of 396.44 g/mol. Its IUPAC name is 2-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]sulfonyl-3-methylbenzoic acid.
| Compound Name | 2-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]sulfonyl-3-methylbenzoic acid |
|---|---|
| PubChem CID | 68532913 |
| Molecular Formula | C22H17FO4S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]sulfonyl-3-methylbenzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1S(=O)(=O)c1ccc(/C=C/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H17FO4S/c1-15-3-2-4-20(22(24)25)21(15)28(26,27)19-13-9-17(10-14-19)6-5-16-7-11-18(23)12-8-16/h2-14H,1H3,(H,24,25)/b6-5+ |
| InChIKey | MDXTZPCPDJQPBU-AATRIKPKSA-N |
| XLogP | 4.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|