C22H23ClF2N4O2 — CID 68535139
[5-chloro-4-fluoro-2-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea (PubChem CID 68535139) has the molecular formula C22H23ClF2N4O2 and a molecular weight of 448.90 g/mol. Its IUPAC name is [5-chloro-4-fluoro-2-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea.
| Compound Name | [5-chloro-4-fluoro-2-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea |
|---|---|
| PubChem CID | 68535139 |
| Molecular Formula | C22H23ClF2N4O2 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [5-chloro-4-fluoro-2-[3-[(2R)-4-[(4-fluorophenyl)methyl]-2-methylpiperazin-1-yl]-3-oxoprop-1-enyl]phenyl]urea |
| SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)CCN1C(=O)C=Cc1cc(F)c(Cl)cc1NC(N)=O |
| InChI | InChI=1S/C22H23ClF2N4O2/c1-14-12-28(13-15-2-5-17(24)6-3-15)8-9-29(14)21(30)7-4-16-10-19(25)18(23)11-20(16)27-22(26)31/h2-7,10-11,14H,8-9,12-13H2,1H3,(H3,26,27,31)/t14-/m1/s1 |
| InChIKey | VDBBMZZUTKNSFN-CQSZACIVSA-N |
| XLogP | 3.85 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|