C26H40N6O4 — CID 68538807
2-[[1-[[(2R)-1-[(1-carbamimidoylpiperidin-4-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]amino]acetic acid (PubChem CID 68538807) has the molecular formula C26H40N6O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[[1-[[(2R)-1-[(1-carbamimidoylpiperidin-4-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]amino]acetic acid.
| Compound Name | 2-[[1-[[(2R)-1-[(1-carbamimidoylpiperidin-4-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 68538807 |
| Molecular Formula | C26H40N6O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 2-[[1-[[(2R)-1-[(1-carbamimidoylpiperidin-4-yl)amino]-1-oxo-3-phenylpropan-2-yl]amino]-3-cyclohexyl-1-oxopropan-2-yl]amino]acetic acid |
| SMILES | [H]/N=C(\N)N1CCC(NC(=O)[C@@H](Cc2ccccc2)NC(=O)C(CC2CCCCC2)NCC(=O)O)CC1 |
| InChI | InChI=1S/C26H40N6O4/c27-26(28)32-13-11-20(12-14-32)30-25(36)22(16-19-9-5-2-6-10-19)31-24(35)21(29-17-23(33)34)15-18-7-3-1-4-8-18/h2,5-6,9-10,18,20-22,29H,1,3-4,7-8,11-17H2,(H3,27,28)(H,30,36)(H,31,35)(H,33,34)/t21?,22-/m1/s1 |
| InChIKey | ACABAFZPAHACDM-FOIFJWKZSA-N |
| XLogP | 1.20 |
| TPSA | 160.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|