C26H34F3N3O2 — CID 68539739
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-7-fluoro-1,2,3,4-tetrahydroquinolin-4-yl]amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 68539739) has the molecular formula C26H34F3N3O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-7-fluoro-1,2,3,4-tetrahydroquinolin-4-yl]amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-7-fluoro-1,2,3,4-tetrahydroquinolin-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 68539739 |
| Molecular Formula | C26H34F3N3O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[(4S)-6-(2,2-dimethylpropyl)-7-fluoro-1,2,3,4-tetrahydroquinolin-4-yl]amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CN[C@H]1CCNc2cc(F)c(CC(C)(C)C)cc21 |
| InChI | InChI=1S/C26H34F3N3O2/c1-15(33)32-24(9-16-7-18(27)11-19(28)8-16)25(34)14-31-22-5-6-30-23-12-21(29)17(10-20(22)23)13-26(2,3)4/h7-8,10-12,22,24-25,30-31,34H,5-6,9,13-14H2,1-4H3,(H,32,33)/t22-,24-,25+/m0/s1 |
| InChIKey | GNDIKMCDPODAPR-ZKMPZPQNSA-N |
| XLogP | 4.25 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |