C21H22N2O5 — CID 68542297
5-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-morpholin-4-ylbenzoic acid (PubChem CID 68542297) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-morpholin-4-ylbenzoic acid.
| Compound Name | 5-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-morpholin-4-ylbenzoic acid |
|---|---|
| PubChem CID | 68542297 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 5-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)-2-morpholin-4-ylbenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)C3C4C=CC(CC4)C3C2=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H22N2O5/c24-19-17-12-1-2-13(4-3-12)18(17)20(25)23(19)14-5-6-16(15(11-14)21(26)27)22-7-9-28-10-8-22/h1-2,5-6,11-13,17-18H,3-4,7-10H2,(H,26,27) |
| InChIKey | DMIXJCRULYGIRK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|