C27H26ClN3O4 — CID 98143407
N-(3-chloro-4-methylphenyl)-5-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-morpholin-4-ylbenzamide (PubChem CID 98143407) has the molecular formula C27H26ClN3O4 and a molecular weight of 491.98 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-5-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-5-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 98143407 |
| Molecular Formula | C27H26ClN3O4 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-5-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-2-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(N3C(=O)[C@@H]4[C@@H](C3=O)[C@H]3C=C[C@H]4C3)ccc2N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C27H26ClN3O4/c1-15-2-5-18(13-21(15)28)29-25(32)20-14-19(6-7-22(20)30-8-10-35-11-9-30)31-26(33)23-16-3-4-17(12-16)24(23)27(31)34/h2-7,13-14,16-17,23-24H,8-12H2,1H3,(H,29,32)/t16-,17-,23-,24-/m0/s1 |
| InChIKey | NUMXBSRZIHGPDJ-KTIFSJKTSA-N |
| XLogP | 4.05 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|