[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid

C10H12BNO4 — CID 68542310

IUPAC[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid
SMILESOCCn1ccc2cc(O)c(B(O)O)cc21
InChIInChI=1S/C10H12BNO4/c13-4-3-12-2-1-7-5-10(14)8(11(15)16)6-9(7)12/h1-2,5-6,13-16H,3-4H2
InChIKeyRULWYCAHEODEMW-UHFFFAOYSA-N
MW221.02 g/mol
LogP-0.98
Rot. Bonds3

About [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid

[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid (PubChem CID 68542310) has the molecular formula C10H12BNO4 and a molecular weight of 221.02 g/mol. Its IUPAC name is [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid.

Molecular Properties

Compound Name[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid
PubChem CID68542310
Molecular FormulaC10H12BNO4
Molecular Weight221.02 g/mol
Exact Mass221.09
IUPAC Name[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid
SMILESOCCn1ccc2cc(O)c(B(O)O)cc21
InChIInChI=1S/C10H12BNO4/c13-4-3-12-2-1-7-5-10(14)8(11(15)16)6-9(7)12/h1-2,5-6,13-16H,3-4H2
InChIKeyRULWYCAHEODEMW-UHFFFAOYSA-N
XLogP-0.98
TPSA85.85 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.02
LogP ≤ 5-0.98
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid?
The IUPAC name of [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid (CID 68542310) is [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid.
What is the SMILES notation for [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid?
The canonical SMILES for [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid is OCCn1ccc2cc(O)c(B(O)O)cc21.
What is the InChIKey of [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid?
The InChIKey is RULWYCAHEODEMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BNO4/c13-4-3-12-2-1-7-5-10(14)8(11(15)16)6-9(7)12/h1-2,5-6,13-16H,3-4H2.
What are the key properties of [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid?
[5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid has a molecular weight of 221.02 g/mol, XLogP of -0.98, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-hydroxy-1-(2-hydroxyethyl)indol-6-yl]boronic acid is sourced from PubChem (CID 68542310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).