C22H28N2O4S — CID 68545500
N-methyl-4-[4-[(3R,4R)-3-(propan-2-ylsulfonylamino)oxan-4-yl]phenyl]benzamide (PubChem CID 68545500) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is N-methyl-4-[4-[(3R,4R)-3-(propan-2-ylsulfonylamino)oxan-4-yl]phenyl]benzamide.
| Compound Name | N-methyl-4-[4-[(3R,4R)-3-(propan-2-ylsulfonylamino)oxan-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 68545500 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-methyl-4-[4-[(3R,4R)-3-(propan-2-ylsulfonylamino)oxan-4-yl]phenyl]benzamide |
| SMILES | CNC(=O)c1ccc(-c2ccc([C@H]3CCOC[C@@H]3NS(=O)(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H28N2O4S/c1-15(2)29(26,27)24-21-14-28-13-12-20(21)18-8-4-16(5-9-18)17-6-10-19(11-7-17)22(25)23-3/h4-11,15,20-21,24H,12-14H2,1-3H3,(H,23,25)/t20-,21+/m1/s1 |
| InChIKey | OBPPZUVOBBSMCI-RTWAWAEBSA-N |
| XLogP | 2.91 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |