C18H24N2O3S2 — CID 70235426
N-[(3R,4S)-4-[4-(5-aminothiophen-2-yl)phenyl]oxan-3-yl]propane-2-sulfonamide (PubChem CID 70235426) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[(3R,4S)-4-[4-(5-aminothiophen-2-yl)phenyl]oxan-3-yl]propane-2-sulfonamide.
| Compound Name | N-[(3R,4S)-4-[4-(5-aminothiophen-2-yl)phenyl]oxan-3-yl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 70235426 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(3R,4S)-4-[4-(5-aminothiophen-2-yl)phenyl]oxan-3-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)N[C@H]1COCC[C@H]1c1ccc(-c2ccc(N)s2)cc1 |
| InChI | InChI=1S/C18H24N2O3S2/c1-12(2)25(21,22)20-16-11-23-10-9-15(16)13-3-5-14(6-4-13)17-7-8-18(19)24-17/h3-8,12,15-16,20H,9-11,19H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | IGCNSAQANFSJIS-HOTGVXAUSA-N |
| XLogP | 3.20 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |