C27H24N6O3S — CID 68547504
2-[(9S)-4,5,13-trimethyl-7-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 68547504) has the molecular formula C27H24N6O3S and a molecular weight of 512.60 g/mol. Its IUPAC name is 2-[(9S)-4,5,13-trimethyl-7-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9S)-4,5,13-trimethyl-7-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 68547504 |
| Molecular Formula | C27H24N6O3S |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-[(9S)-4,5,13-trimethyl-7-[4-(3-pyridin-3-ylprop-2-enoylamino)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(NC(=O)C=Cc3cccnc3)cc1)=N[C@@H](CC(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C27H24N6O3S/c1-15-16(2)37-27-24(15)25(30-21(13-23(35)36)26-32-31-17(3)33(26)27)19-7-9-20(10-8-19)29-22(34)11-6-18-5-4-12-28-14-18/h4-12,14,21H,13H2,1-3H3,(H,29,34)(H,35,36)/t21-/m0/s1 |
| InChIKey | LQVFQCJPOIEWHS-NRFANRHFSA-N |
| XLogP | 4.67 |
| TPSA | 122.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|