C28H26N4O3S — CID 68543967
2-[(9S)-4,5,13-trimethyl-7-[4-(3-prop-2-enoxyphenyl)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 68543967) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is 2-[(9S)-4,5,13-trimethyl-7-[4-(3-prop-2-enoxyphenyl)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9S)-4,5,13-trimethyl-7-[4-(3-prop-2-enoxyphenyl)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 68543967 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 2-[(9S)-4,5,13-trimethyl-7-[4-(3-prop-2-enoxyphenyl)phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | C=CCOc1cccc(-c2ccc(C3=N[C@@H](CC(=O)O)c4nnc(C)n4-c4sc(C)c(C)c43)cc2)c1 |
| InChI | InChI=1S/C28H26N4O3S/c1-5-13-35-22-8-6-7-21(14-22)19-9-11-20(12-10-19)26-25-16(2)17(3)36-28(25)32-18(4)30-31-27(32)23(29-26)15-24(33)34/h5-12,14,23H,1,13,15H2,2-4H3,(H,33,34)/t23-/m0/s1 |
| InChIKey | HUVYAGKVFZKOGH-QHCPKHFHSA-N |
| XLogP | 5.85 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|