C29H27N5O3S — CID 68550917
2-[(9S)-4,5,13-trimethyl-7-[4-[methyl-[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 68550917) has the molecular formula C29H27N5O3S and a molecular weight of 525.63 g/mol. Its IUPAC name is 2-[(9S)-4,5,13-trimethyl-7-[4-[methyl-[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9S)-4,5,13-trimethyl-7-[4-[methyl-[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 68550917 |
| Molecular Formula | C29H27N5O3S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[(9S)-4,5,13-trimethyl-7-[4-[methyl-[(E)-3-phenylprop-2-enoyl]amino]phenyl]-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(N(C)C(=O)/C=C/c3ccccc3)cc1)=N[C@@H](CC(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H27N5O3S/c1-17-18(2)38-29-26(17)27(30-23(16-25(36)37)28-32-31-19(3)34(28)29)21-11-13-22(14-12-21)33(4)24(35)15-10-20-8-6-5-7-9-20/h5-15,23H,16H2,1-4H3,(H,36,37)/b15-10+/t23-/m0/s1 |
| InChIKey | NOHBFKNUZUFCBB-VOCPSOEZSA-N |
| XLogP | 5.30 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|