About ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate
ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate (PubChem CID 68549277) has the molecular formula C22H21F3N2O5
and a molecular weight of 450.41 g/mol. Its IUPAC name is ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate |
| PubChem CID | 68549277 |
| Molecular Formula | C22H21F3N2O5 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(Cc2cnco2)c2ccc(OC(F)(F)F)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H21F3N2O5/c1-3-29-20-11-17(9-10-19(20)32-22(23,24)25)27(13-18-12-26-14-31-18)16-7-5-15(6-8-16)21(28)30-4-2/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | JDLZMZZLMNYAGX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate?
The IUPAC name of ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate (CID 68549277) is ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate.
What is the SMILES notation for ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate?
The canonical SMILES for ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate is CCOC(=O)c1ccc(N(Cc2cnco2)c2ccc(OC(F)(F)F)c(OCC)c2)cc1.
What is the InChIKey of ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate?
The InChIKey is JDLZMZZLMNYAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F3N2O5/c1-3-29-20-11-17(9-10-19(20)32-22(23,24)25)27(13-18-12-26-14-31-18)16-7-5-15(6-8-16)21(28)30-4-2/h5-12,14H,3-4,13H2,1-2H3.
What are the key properties of ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate?
ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate has a molecular weight of 450.41 g/mol, XLogP of 5.49, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-ethoxy-N-(1,3-oxazol-5-ylmethyl)-4-(trifluoromethoxy)anilino]benzoate is sourced from PubChem (CID 68549277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).