C11H18Cl2N4OS — CID 68551844
2-[[2-(dimethylamino)-1,3-benzothiazol-4-yl]oxy]ethane-1,1-diamine;dihydrochloride (PubChem CID 68551844) has the molecular formula C11H18Cl2N4OS and a molecular weight of 325.27 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-1,3-benzothiazol-4-yl]oxy]ethane-1,1-diamine;dihydrochloride.
| Compound Name | 2-[[2-(dimethylamino)-1,3-benzothiazol-4-yl]oxy]ethane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 68551844 |
| Molecular Formula | C11H18Cl2N4OS |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-[[2-(dimethylamino)-1,3-benzothiazol-4-yl]oxy]ethane-1,1-diamine;dihydrochloride |
| SMILES | CN(C)c1nc2c(OCC(N)N)cccc2s1.Cl.Cl |
| InChI | InChI=1S/C11H16N4OS.2ClH/c1-15(2)11-14-10-7(16-6-9(12)13)4-3-5-8(10)17-11;;/h3-5,9H,6,12-13H2,1-2H3;2*1H |
| InChIKey | PYVVDUIJOPRDGK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|