C31H37N5O3SSi — CID 68552473
2-[(9S)-7-(4-anilinophenyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid (PubChem CID 68552473) has the molecular formula C31H37N5O3SSi and a molecular weight of 587.82 g/mol. Its IUPAC name is 2-[(9S)-7-(4-anilinophenyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid.
| Compound Name | 2-[(9S)-7-(4-anilinophenyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
|---|---|
| PubChem CID | 68552473 |
| Molecular Formula | C31H37N5O3SSi |
| Molecular Weight | 587.82 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 2-[(9S)-7-(4-anilinophenyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,13-dimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetic acid |
| SMILES | Cc1c(CO[Si](C)(C)C(C)(C)C)sc2c1C(c1ccc(Nc3ccccc3)cc1)=N[C@@H](CC(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C31H37N5O3SSi/c1-19-25(18-39-41(6,7)31(3,4)5)40-30-27(19)28(33-24(17-26(37)38)29-35-34-20(2)36(29)30)21-13-15-23(16-14-21)32-22-11-9-8-10-12-22/h8-16,24,32H,17-18H2,1-7H3,(H,37,38)/t24-/m0/s1 |
| InChIKey | UMTRBNLDBHOHJJ-DEOSSOPVSA-N |
| XLogP | 7.58 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.82 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|