C16H13FN4OS — CID 68553648
N-(4-fluorophenyl)-6-(thiophen-3-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 68553648) has the molecular formula C16H13FN4OS and a molecular weight of 328.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-6-(thiophen-3-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(4-fluorophenyl)-6-(thiophen-3-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 68553648 |
| Molecular Formula | C16H13FN4OS |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | N-(4-fluorophenyl)-6-(thiophen-3-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(NCc2ccsc2)ncn1 |
| InChI | InChI=1S/C16H13FN4OS/c17-12-1-3-13(4-2-12)21-16(22)14-7-15(20-10-19-14)18-8-11-5-6-23-9-11/h1-7,9-10H,8H2,(H,21,22)(H,18,19,20) |
| InChIKey | IZNIEOIVQPZKRC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |