C22H22F4N6 — CID 68554624
1-(3-fluorophenyl)-4-methyl-7-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 68554624) has the molecular formula C22H22F4N6 and a molecular weight of 446.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-methyl-7-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 1-(3-fluorophenyl)-4-methyl-7-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 68554624 |
| Molecular Formula | C22H22F4N6 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 1-(3-fluorophenyl)-4-methyl-7-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CN1CCN(c2cccc(F)c2)c2ccc(N3CCn4c(nnc4C(F)(F)F)C3)cc2C1 |
| InChI | InChI=1S/C22H22F4N6/c1-29-7-9-31(18-4-2-3-16(23)12-18)19-6-5-17(11-15(19)13-29)30-8-10-32-20(14-30)27-28-21(32)22(24,25)26/h2-6,11-12H,7-10,13-14H2,1H3 |
| InChIKey | ZJCHRRZOHZFUQK-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|