C22H30N4O2S — CID 68658949
7-(4-ethylsulfonylpiperazin-1-yl)-4-methyl-1-phenyl-3,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 68658949) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is 7-(4-ethylsulfonylpiperazin-1-yl)-4-methyl-1-phenyl-3,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 7-(4-ethylsulfonylpiperazin-1-yl)-4-methyl-1-phenyl-3,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 68658949 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 7-(4-ethylsulfonylpiperazin-1-yl)-4-methyl-1-phenyl-3,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc3c(c2)CN(C)CCN3c2ccccc2)CC1 |
| InChI | InChI=1S/C22H30N4O2S/c1-3-29(27,28)25-14-12-24(13-15-25)21-9-10-22-19(17-21)18-23(2)11-16-26(22)20-7-5-4-6-8-20/h4-10,17H,3,11-16,18H2,1-2H3 |
| InChIKey | JTVWIECCTMQAKF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|