C9H9F2N3 — CID 68555475
1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine (PubChem CID 68555475) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine.
| Compound Name | 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine |
|---|---|
| PubChem CID | 68555475 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine |
| SMILES | CC(N)c1cn2cc(F)cc(F)c2n1 |
| InChI | InChI=1S/C9H9F2N3/c1-5(12)8-4-14-3-6(10)2-7(11)9(14)13-8/h2-5H,12H2,1H3 |
| InChIKey | VZZPTFRAEZEMTH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |