About 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine
1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine (PubChem CID 68555475) has the molecular formula C9H9F2N3
and a molecular weight of 197.19 g/mol. Its IUPAC name is 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine |
| PubChem CID | 68555475 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine |
| SMILES | CC(N)c1cn2cc(F)cc(F)c2n1 |
| InChI | InChI=1S/C9H9F2N3/c1-5(12)8-4-14-3-6(10)2-7(11)9(14)13-8/h2-5H,12H2,1H3 |
| InChIKey | VZZPTFRAEZEMTH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine?
The IUPAC name of 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine (CID 68555475) is 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine.
What is the SMILES notation for 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine?
The canonical SMILES for 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine is CC(N)c1cn2cc(F)cc(F)c2n1.
What is the InChIKey of 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine?
The InChIKey is VZZPTFRAEZEMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2N3/c1-5(12)8-4-14-3-6(10)2-7(11)9(14)13-8/h2-5H,12H2,1H3.
What are the key properties of 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine?
1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine has a molecular weight of 197.19 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,8-difluoroimidazo[1,2-a]pyridin-2-yl)ethanamine is sourced from PubChem (CID 68555475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).