C9H17NO2 — CID 68570933
7a-ethyl-2,6-dimethyl-2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazole (PubChem CID 68570933) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 7a-ethyl-2,6-dimethyl-2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazole.
| Compound Name | 7a-ethyl-2,6-dimethyl-2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazole |
|---|---|
| PubChem CID | 68570933 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 7a-ethyl-2,6-dimethyl-2,3,5,6-tetrahydro-[1,3]oxazolo[2,3-b][1,3]oxazole |
| SMILES | CCC12OC(C)CN1CC(C)O2 |
| InChI | InChI=1S/C9H17NO2/c1-4-9-10(5-7(2)11-9)6-8(3)12-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | KMWIMQVQXWPMCS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |