C22H19NO4 — CID 68571937
(2S)-2-amino-3-[2-(2-benzoylphenyl)-4-hydroxyphenyl]propanoic acid (PubChem CID 68571937) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is (2S)-2-amino-3-[2-(2-benzoylphenyl)-4-hydroxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[2-(2-benzoylphenyl)-4-hydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 68571937 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (2S)-2-amino-3-[2-(2-benzoylphenyl)-4-hydroxyphenyl]propanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1-c1ccccc1C(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H19NO4/c23-20(22(26)27)12-15-10-11-16(24)13-19(15)17-8-4-5-9-18(17)21(25)14-6-2-1-3-7-14/h1-11,13,20,24H,12,23H2,(H,26,27)/t20-/m0/s1 |
| InChIKey | NKLFRFOOLGQIHM-FQEVSTJZSA-N |
| XLogP | 3.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |