C20H22N2 — CID 68572649
N-pentyl-3-phenylquinolin-2-amine (PubChem CID 68572649) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-pentyl-3-phenylquinolin-2-amine.
| Compound Name | N-pentyl-3-phenylquinolin-2-amine |
|---|---|
| PubChem CID | 68572649 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-pentyl-3-phenylquinolin-2-amine |
| SMILES | CCCCCNc1nc2ccccc2cc1-c1ccccc1 |
| InChI | InChI=1S/C20H22N2/c1-2-3-9-14-21-20-18(16-10-5-4-6-11-16)15-17-12-7-8-13-19(17)22-20/h4-8,10-13,15H,2-3,9,14H2,1H3,(H,21,22) |
| InChIKey | CGKYIBFMYBGTIV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|