C24H28FN5O — CID 68576363
(4,6-dimethylpyrimidin-5-yl)-[5-[2-[3-(3-fluorophenyl)azetidin-3-yl]ethyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone (PubChem CID 68576363) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is (4,6-dimethylpyrimidin-5-yl)-[5-[2-[3-(3-fluorophenyl)azetidin-3-yl]ethyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone.
| Compound Name | (4,6-dimethylpyrimidin-5-yl)-[5-[2-[3-(3-fluorophenyl)azetidin-3-yl]ethyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 68576363 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (4,6-dimethylpyrimidin-5-yl)-[5-[2-[3-(3-fluorophenyl)azetidin-3-yl]ethyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]methanone |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2=CN(CCC3(c4cccc(F)c4)CNC3)CC2C1 |
| InChI | InChI=1S/C24H28FN5O/c1-16-22(17(2)28-15-27-16)23(31)30-11-18-9-29(10-19(18)12-30)7-6-24(13-26-14-24)20-4-3-5-21(25)8-20/h3-5,8-9,15,19,26H,6-7,10-14H2,1-2H3 |
| InChIKey | GACKCZKXFOWZGU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |