C23H28FN5O3 — CID 69147469
3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl-(3-fluorophenyl)carbamic acid (PubChem CID 69147469) has the molecular formula C23H28FN5O3 and a molecular weight of 441.51 g/mol. Its IUPAC name is 3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl-(3-fluorophenyl)carbamic acid.
| Compound Name | 3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl-(3-fluorophenyl)carbamic acid |
|---|---|
| PubChem CID | 69147469 |
| Molecular Formula | C23H28FN5O3 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-[5-(4,6-dimethylpyrimidine-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]propyl-(3-fluorophenyl)carbamic acid |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2CN(CCCN(C(=O)O)c3cccc(F)c3)CC2C1 |
| InChI | InChI=1S/C23H28FN5O3/c1-15-21(16(2)26-14-25-15)22(30)28-12-17-10-27(11-18(17)13-28)7-4-8-29(23(31)32)20-6-3-5-19(24)9-20/h3,5-6,9,14,17-18H,4,7-8,10-13H2,1-2H3,(H,31,32) |
| InChIKey | FWYISQNXPULLNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |