C28H35N5O3S — CID 68576790
[5-[3-(1-cyclopropylsulfonylazetidin-3-yl)-3-phenylpropyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(4,6-dimethylpyrimidin-5-yl)methanone (PubChem CID 68576790) has the molecular formula C28H35N5O3S and a molecular weight of 521.69 g/mol. Its IUPAC name is [5-[3-(1-cyclopropylsulfonylazetidin-3-yl)-3-phenylpropyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(4,6-dimethylpyrimidin-5-yl)methanone.
| Compound Name | [5-[3-(1-cyclopropylsulfonylazetidin-3-yl)-3-phenylpropyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(4,6-dimethylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 68576790 |
| Molecular Formula | C28H35N5O3S |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | [5-[3-(1-cyclopropylsulfonylazetidin-3-yl)-3-phenylpropyl]-1,3,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-2-yl]-(4,6-dimethylpyrimidin-5-yl)methanone |
| SMILES | Cc1ncnc(C)c1C(=O)N1CC2=CN(CCC(c3ccccc3)C3CN(S(=O)(=O)C4CC4)C3)CC2C1 |
| InChI | InChI=1S/C28H35N5O3S/c1-19-27(20(2)30-18-29-19)28(34)32-14-22-12-31(13-23(22)15-32)11-10-26(21-6-4-3-5-7-21)24-16-33(17-24)37(35,36)25-8-9-25/h3-7,12,18,23-26H,8-11,13-17H2,1-2H3 |
| InChIKey | VYLCQBNQTMWKAC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |