C14H21NS — CID 68581811
N,N-dimethyl-2-(2-phenylbut-1-enylsulfanyl)ethanamine (PubChem CID 68581811) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-phenylbut-1-enylsulfanyl)ethanamine.
| Compound Name | N,N-dimethyl-2-(2-phenylbut-1-enylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 68581811 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N,N-dimethyl-2-(2-phenylbut-1-enylsulfanyl)ethanamine |
| SMILES | CCC(=CSCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H21NS/c1-4-13(12-16-11-10-15(2)3)14-8-6-5-7-9-14/h5-9,12H,4,10-11H2,1-3H3 |
| InChIKey | ZHOIEBWQBGLOSE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|