C20H27N3O3 — CID 68582786
ethyl 6-[3-(cyclopropylamino)propyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate (PubChem CID 68582786) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 6-[3-(cyclopropylamino)propyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate.
| Compound Name | ethyl 6-[3-(cyclopropylamino)propyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 68582786 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | ethyl 6-[3-(cyclopropylamino)propyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cn(N(C)C)c2ccc(CCCNC3CC3)cc2c1=O |
| InChI | InChI=1S/C20H27N3O3/c1-4-26-20(25)17-13-23(22(2)3)18-10-7-14(12-16(18)19(17)24)6-5-11-21-15-8-9-15/h7,10,12-13,15,21H,4-6,8-9,11H2,1-3H3 |
| InChIKey | CBJHDUMQMKOPEQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|