C27H38N2O7S — CID 68583502
tert-butyl 4-[4-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]cyclohexyl]benzoate (PubChem CID 68583502) has the molecular formula C27H38N2O7S and a molecular weight of 534.68 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]cyclohexyl]benzoate.
| Compound Name | tert-butyl 4-[4-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]cyclohexyl]benzoate |
|---|---|
| PubChem CID | 68583502 |
| Molecular Formula | C27H38N2O7S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | tert-butyl 4-[4-[[(2S)-2-hydroxy-3-[4-hydroxy-3-(methanesulfonamido)phenoxy]propyl]amino]cyclohexyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(C2CCC(NC[C@H](O)COc3ccc(O)c(NS(C)(=O)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C27H38N2O7S/c1-27(2,3)36-26(32)20-7-5-18(6-8-20)19-9-11-21(12-10-19)28-16-22(30)17-35-23-13-14-25(31)24(15-23)29-37(4,33)34/h5-8,13-15,19,21-22,28-31H,9-12,16-17H2,1-4H3/t19?,21?,22-/m0/s1 |
| InChIKey | YRIVMZFINHDRBR-VTLFHKLASA-N |
| XLogP | 3.77 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|