C18H15BrN2O — CID 68585517
7-bromo-2-tert-butyl-6-phenyl-1,3-benzoxazole-4-carbonitrile (PubChem CID 68585517) has the molecular formula C18H15BrN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is 7-bromo-2-tert-butyl-6-phenyl-1,3-benzoxazole-4-carbonitrile.
| Compound Name | 7-bromo-2-tert-butyl-6-phenyl-1,3-benzoxazole-4-carbonitrile |
|---|---|
| PubChem CID | 68585517 |
| Molecular Formula | C18H15BrN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 7-bromo-2-tert-butyl-6-phenyl-1,3-benzoxazole-4-carbonitrile |
| SMILES | CC(C)(C)c1nc2c(C#N)cc(-c3ccccc3)c(Br)c2o1 |
| InChI | InChI=1S/C18H15BrN2O/c1-18(2,3)17-21-15-12(10-20)9-13(14(19)16(15)22-17)11-7-5-4-6-8-11/h4-9H,1-3H3 |
| InChIKey | OCWYJDQWYMEXGX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |