About CID 68585929
CID 68585929 (PubChem CID 68585929) has the molecular formula C48H68O5Si2
and a molecular weight of 781.24 g/mol.
Molecular Properties
| Compound Name | CID 68585929 |
| PubChem CID | 68585929 |
| Molecular Formula | C48H68O5Si2 |
| Molecular Weight | 781.24 g/mol |
| Exact Mass | 780.46 |
| IUPAC Name | — |
| SMILES | CCCCOc1cccc([Si](O[Si](c2cccc(OCCCC)c2CC)c2cccc(OCCCC)c2CC)c2cccc(OCCCC)c2CC)c1CC |
| InChI | InChI=1S/C48H68O5Si2/c1-9-17-33-49-41-25-21-29-45(37(41)13-5)54(46-30-22-26-42(38(46)14-6)50-34-18-10-2)53-55(47-31-23-27-43(39(47)15-7)51-35-19-11-3)48-32-24-28-44(40(48)16-8)52-36-20-12-4/h21-32H,9-20,33-36H2,1-8H3 |
| InChIKey | HENFEXWRRRBLON-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 781.24 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68585929 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68585929?
The IUPAC name of CID 68585929 (CID 68585929) is not available.
What is the SMILES notation for CID 68585929?
The canonical SMILES for CID 68585929 is CCCCOc1cccc([Si](O[Si](c2cccc(OCCCC)c2CC)c2cccc(OCCCC)c2CC)c2cccc(OCCCC)c2CC)c1CC.
What is the InChIKey of CID 68585929?
The InChIKey is HENFEXWRRRBLON-UHFFFAOYSA-N. The full InChI is InChI=1S/C48H68O5Si2/c1-9-17-33-49-41-25-21-29-45(37(41)13-5)54(46-30-22-26-42(38(46)14-6)50-34-18-10-2)53-55(47-31-23-27-43(39(47)15-7)51-35-19-11-3)48-32-24-28-44(40(48)16-8)52-36-20-12-4/h21-32H,9-20,33-36H2,1-8H3.
What are the key properties of CID 68585929?
CID 68585929 has a molecular weight of 781.24 g/mol, XLogP of 9.58, 26 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68585929 is sourced from PubChem (CID 68585929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).