C19H20FIN2O — CID 68589909
N-cyclopropyl-N'-[4-(3-fluoro-5-iodophenoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 68589909) has the molecular formula C19H20FIN2O and a molecular weight of 438.28 g/mol. Its IUPAC name is N-cyclopropyl-N'-[4-(3-fluoro-5-iodophenoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-cyclopropyl-N'-[4-(3-fluoro-5-iodophenoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 68589909 |
| Molecular Formula | C19H20FIN2O |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-cyclopropyl-N'-[4-(3-fluoro-5-iodophenoxy)-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | Cc1cc(Oc2cc(F)cc(I)c2)c(C)cc1/N=C/N(C)C1CC1 |
| InChI | InChI=1S/C19H20FIN2O/c1-12-7-19(24-17-9-14(20)8-15(21)10-17)13(2)6-18(12)22-11-23(3)16-4-5-16/h6-11,16H,4-5H2,1-3H3/b22-11+ |
| InChIKey | KVWRIFNFNAAXFF-SSDVNMTOSA-N |
| XLogP | 5.59 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|