C12H21P — CID 68592204
(1,2-dimethyl-2-adamantyl)phosphane (PubChem CID 68592204) has the molecular formula C12H21P and a molecular weight of 196.27 g/mol. Its IUPAC name is (1,2-dimethyl-2-adamantyl)phosphane.
| Compound Name | (1,2-dimethyl-2-adamantyl)phosphane |
|---|---|
| PubChem CID | 68592204 |
| Molecular Formula | C12H21P |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | (1,2-dimethyl-2-adamantyl)phosphane |
| SMILES | CC12CC3CC(CC(C3)C1(C)P)C2 |
| InChI | InChI=1S/C12H21P/c1-11-6-8-3-9(7-11)5-10(4-8)12(11,2)13/h8-10H,3-7,13H2,1-2H3 |
| InChIKey | UZWKOTPZWBKTTG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|