C26H27FN6 — CID 68594254
2-[4-[(5-ethyl-1H-pyrazol-4-yl)-phenylmethyl]piperazin-1-yl]-3-(4-fluorophenyl)pyrazine (PubChem CID 68594254) has the molecular formula C26H27FN6 and a molecular weight of 442.54 g/mol. Its IUPAC name is 2-[4-[(5-ethyl-1H-pyrazol-4-yl)-phenylmethyl]piperazin-1-yl]-3-(4-fluorophenyl)pyrazine.
| Compound Name | 2-[4-[(5-ethyl-1H-pyrazol-4-yl)-phenylmethyl]piperazin-1-yl]-3-(4-fluorophenyl)pyrazine |
|---|---|
| PubChem CID | 68594254 |
| Molecular Formula | C26H27FN6 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[4-[(5-ethyl-1H-pyrazol-4-yl)-phenylmethyl]piperazin-1-yl]-3-(4-fluorophenyl)pyrazine |
| SMILES | CCc1[nH]ncc1C(c1ccccc1)N1CCN(c2nccnc2-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H27FN6/c1-2-23-22(18-30-31-23)25(20-6-4-3-5-7-20)32-14-16-33(17-15-32)26-24(28-12-13-29-26)19-8-10-21(27)11-9-19/h3-13,18,25H,2,14-17H2,1H3,(H,30,31) |
| InChIKey | GNAFUHJKCSOIIJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |