C12H8BrFN2O3 — CID 68596924
3-[2-(2-bromo-5-fluorophenoxy)ethoxy]-1,2-oxazole-5-carbonitrile (PubChem CID 68596924) has the molecular formula C12H8BrFN2O3 and a molecular weight of 327.11 g/mol. Its IUPAC name is 3-[2-(2-bromo-5-fluorophenoxy)ethoxy]-1,2-oxazole-5-carbonitrile.
| Compound Name | 3-[2-(2-bromo-5-fluorophenoxy)ethoxy]-1,2-oxazole-5-carbonitrile |
|---|---|
| PubChem CID | 68596924 |
| Molecular Formula | C12H8BrFN2O3 |
| Molecular Weight | 327.11 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 3-[2-(2-bromo-5-fluorophenoxy)ethoxy]-1,2-oxazole-5-carbonitrile |
| SMILES | N#Cc1cc(OCCOc2cc(F)ccc2Br)no1 |
| InChI | InChI=1S/C12H8BrFN2O3/c13-10-2-1-8(14)5-11(10)17-3-4-18-12-6-9(7-15)19-16-12/h1-2,5-6H,3-4H2 |
| InChIKey | SHDKZQKIIBXASC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.11 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|