C22H28O2 — CID 68598342
(8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-prop-1-en-2-yl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 68598342) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-prop-1-en-2-yl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-prop-1-en-2-yl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 68598342 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-11-hydroxy-10,13-dimethyl-17-prop-1-en-2-yl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@]12C |
| InChI | InChI=1S/C22H28O2/c1-13(2)17-7-8-18-16-6-5-14-11-15(23)9-10-21(14,3)20(16)19(24)12-22(17,18)4/h5-6,9-11,16-20,24H,1,7-8,12H2,2-4H3/t16-,17+,18-,19?,20+,21-,22+/m0/s1 |
| InChIKey | DUKCWQWWAUCRFS-WTIXHABMSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|