C16H23Cl2N3O2 — CID 68603759
2-phenylethyl (2S)-2-(ethylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride (PubChem CID 68603759) has the molecular formula C16H23Cl2N3O2 and a molecular weight of 360.29 g/mol. Its IUPAC name is 2-phenylethyl (2S)-2-(ethylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride.
| Compound Name | 2-phenylethyl (2S)-2-(ethylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride |
|---|---|
| PubChem CID | 68603759 |
| Molecular Formula | C16H23Cl2N3O2 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-phenylethyl (2S)-2-(ethylamino)-3-(1H-imidazol-5-yl)propanoate;dihydrochloride |
| SMILES | CCN[C@@H](Cc1cnc[nH]1)C(=O)OCCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C16H21N3O2.2ClH/c1-2-18-15(10-14-11-17-12-19-14)16(20)21-9-8-13-6-4-3-5-7-13;;/h3-7,11-12,15,18H,2,8-10H2,1H3,(H,17,19);2*1H/t15-;;/m0../s1 |
| InChIKey | OTYZCOJJWWYXRJ-CKUXDGONSA-N |
| XLogP | 2.56 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |