C22H28ClFN2O — CID 68605128
4-[5-[(2-cyclohexylethylamino)methyl]-2-fluorophenyl]benzamide;hydrochloride (PubChem CID 68605128) has the molecular formula C22H28ClFN2O and a molecular weight of 390.93 g/mol. Its IUPAC name is 4-[5-[(2-cyclohexylethylamino)methyl]-2-fluorophenyl]benzamide;hydrochloride.
| Compound Name | 4-[5-[(2-cyclohexylethylamino)methyl]-2-fluorophenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 68605128 |
| Molecular Formula | C22H28ClFN2O |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-[5-[(2-cyclohexylethylamino)methyl]-2-fluorophenyl]benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(-c2cc(CNCCC3CCCCC3)ccc2F)cc1 |
| InChI | InChI=1S/C22H27FN2O.ClH/c23-21-11-6-17(15-25-13-12-16-4-2-1-3-5-16)14-20(21)18-7-9-19(10-8-18)22(24)26;/h6-11,14,16,25H,1-5,12-13,15H2,(H2,24,26);1H |
| InChIKey | JZSBTQXRTFKVQM-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|