C15H13FN4S — CID 68607179
2-(fluoromethyl)-4-[4-(2-methylpyrazolo[1,5-a]pyrimidin-5-yl)but-1-ynyl]-1,3-thiazole (PubChem CID 68607179) has the molecular formula C15H13FN4S and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-(fluoromethyl)-4-[4-(2-methylpyrazolo[1,5-a]pyrimidin-5-yl)but-1-ynyl]-1,3-thiazole.
| Compound Name | 2-(fluoromethyl)-4-[4-(2-methylpyrazolo[1,5-a]pyrimidin-5-yl)but-1-ynyl]-1,3-thiazole |
|---|---|
| PubChem CID | 68607179 |
| Molecular Formula | C15H13FN4S |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(fluoromethyl)-4-[4-(2-methylpyrazolo[1,5-a]pyrimidin-5-yl)but-1-ynyl]-1,3-thiazole |
| SMILES | Cc1cc2nc(CCC#Cc3csc(CF)n3)ccn2n1 |
| InChI | InChI=1S/C15H13FN4S/c1-11-8-14-17-12(6-7-20(14)19-11)4-2-3-5-13-10-21-15(9-16)18-13/h6-8,10H,2,4,9H2,1H3 |
| InChIKey | IBFTUQNZAKJNLN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|