C9H11NS — CID 59571079
4-methyl-2-pent-1-ynyl-1,3-thiazole (PubChem CID 59571079) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-methyl-2-pent-1-ynyl-1,3-thiazole.
| Compound Name | 4-methyl-2-pent-1-ynyl-1,3-thiazole |
|---|---|
| PubChem CID | 59571079 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-methyl-2-pent-1-ynyl-1,3-thiazole |
| SMILES | CCCC#Cc1nc(C)cs1 |
| InChI | InChI=1S/C9H11NS/c1-3-4-5-6-9-10-8(2)7-11-9/h7H,3-4H2,1-2H3 |
| InChIKey | QORMXECODHDZFF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|