C6H4INS2 — CID 155462373
2-(4-methyl-1,3-thiazol-2-yl)ethynyl thiohypoiodite (PubChem CID 155462373) has the molecular formula C6H4INS2 and a molecular weight of 281.14 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)ethynyl thiohypoiodite.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 155462373 |
| Molecular Formula | C6H4INS2 |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.88 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)ethynyl thiohypoiodite |
| SMILES | Cc1csc(C#CSI)n1 |
| InChI | InChI=1S/C6H4INS2/c1-5-4-9-6(8-5)2-3-10-7/h4H,1H3 |
| InChIKey | BSBCSMHJJCEMAB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|