C13H11NS — CID 138979346
4-methyl-2-(3-phenylprop-2-ynyl)-1,3-thiazole (PubChem CID 138979346) has the molecular formula C13H11NS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-methyl-2-(3-phenylprop-2-ynyl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(3-phenylprop-2-ynyl)-1,3-thiazole |
|---|---|
| PubChem CID | 138979346 |
| Molecular Formula | C13H11NS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-methyl-2-(3-phenylprop-2-ynyl)-1,3-thiazole |
| SMILES | Cc1csc(CC#Cc2ccccc2)n1 |
| InChI | InChI=1S/C13H11NS/c1-11-10-15-13(14-11)9-5-8-12-6-3-2-4-7-12/h2-4,6-7,10H,9H2,1H3 |
| InChIKey | MBXFNBUTVUABFN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|