C8H9NS2 — CID 131019687
4-methyl-2-(prop-2-ynylsulfanylmethyl)-1,3-thiazole (PubChem CID 131019687) has the molecular formula C8H9NS2 and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-methyl-2-(prop-2-ynylsulfanylmethyl)-1,3-thiazole.
| Compound Name | 4-methyl-2-(prop-2-ynylsulfanylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 131019687 |
| Molecular Formula | C8H9NS2 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 4-methyl-2-(prop-2-ynylsulfanylmethyl)-1,3-thiazole |
| SMILES | C#CCSCc1nc(C)cs1 |
| InChI | InChI=1S/C8H9NS2/c1-3-4-10-6-8-9-7(2)5-11-8/h1,5H,4,6H2,2H3 |
| InChIKey | KFEKJQFOMUGPRQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|