C25H42F3N3O5S — CID 68608107
3-(dipropylsulfamoyl)-N-[(2S,3S)-3-hydroxy-4-(3-methylbutylamino)-1-[3-(trifluoromethoxy)phenyl]butan-2-yl]propanamide (PubChem CID 68608107) has the molecular formula C25H42F3N3O5S and a molecular weight of 553.69 g/mol. Its IUPAC name is 3-(dipropylsulfamoyl)-N-[(2S,3S)-3-hydroxy-4-(3-methylbutylamino)-1-[3-(trifluoromethoxy)phenyl]butan-2-yl]propanamide.
| Compound Name | 3-(dipropylsulfamoyl)-N-[(2S,3S)-3-hydroxy-4-(3-methylbutylamino)-1-[3-(trifluoromethoxy)phenyl]butan-2-yl]propanamide |
|---|---|
| PubChem CID | 68608107 |
| Molecular Formula | C25H42F3N3O5S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | 3-(dipropylsulfamoyl)-N-[(2S,3S)-3-hydroxy-4-(3-methylbutylamino)-1-[3-(trifluoromethoxy)phenyl]butan-2-yl]propanamide |
| SMILES | CCCN(CCC)S(=O)(=O)CCC(=O)N[C@@H](Cc1cccc(OC(F)(F)F)c1)[C@@H](O)CNCCC(C)C |
| InChI | InChI=1S/C25H42F3N3O5S/c1-5-13-31(14-6-2)37(34,35)15-11-24(33)30-22(23(32)18-29-12-10-19(3)4)17-20-8-7-9-21(16-20)36-25(26,27)28/h7-9,16,19,22-23,29,32H,5-6,10-15,17-18H2,1-4H3,(H,30,33)/t22-,23-/m0/s1 |
| InChIKey | PLDUFBUXTVVSAL-GOTSBHOMSA-N |
| XLogP | 3.45 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|