C27H47N3O4 — CID 68611646
2-[(2S,3R)-3-hydroxy-1-(3-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-N',N'-dipropylpentanediamide (PubChem CID 68611646) has the molecular formula C27H47N3O4 and a molecular weight of 477.69 g/mol. Its IUPAC name is 2-[(2S,3R)-3-hydroxy-1-(3-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-N',N'-dipropylpentanediamide.
| Compound Name | 2-[(2S,3R)-3-hydroxy-1-(3-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 68611646 |
| Molecular Formula | C27H47N3O4 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.36 |
| IUPAC Name | 2-[(2S,3R)-3-hydroxy-1-(3-methoxyphenyl)-4-(3-methylbutylamino)butan-2-yl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCC(C(N)=O)[C@H](Cc1cccc(OC)c1)[C@@H](O)CNCCC(C)C |
| InChI | InChI=1S/C27H47N3O4/c1-6-15-30(16-7-2)26(32)12-11-23(27(28)33)24(25(31)19-29-14-13-20(3)4)18-21-9-8-10-22(17-21)34-5/h8-10,17,20,23-25,29,31H,6-7,11-16,18-19H2,1-5H3,(H2,28,33)/t23?,24-,25-/m0/s1 |
| InChIKey | OLAJZCACZKYLIF-DJHGOXGWSA-N |
| XLogP | 3.38 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|