C37H50N4O5 — CID 68610193
1-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-(3-phenylmethoxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 68610193) has the molecular formula C37H50N4O5 and a molecular weight of 630.83 g/mol. Its IUPAC name is 1-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-(3-phenylmethoxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-(3-phenylmethoxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 68610193 |
| Molecular Formula | C37H50N4O5 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | 1-N-[(2S,3R)-3-hydroxy-4-(3-methylbutylamino)-1-(3-phenylmethoxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](Cc2cccc(OCc3ccccc3)c2)[C@H](O)CNCCC(C)C)c1 |
| InChI | InChI=1S/C37H50N4O5/c1-5-17-41(18-6-2)37(45)31-22-29(35(38)43)21-30(23-31)36(44)40-33(34(42)24-39-16-15-26(3)4)20-28-13-10-14-32(19-28)46-25-27-11-8-7-9-12-27/h7-14,19,21-23,26,33-34,39,42H,5-6,15-18,20,24-25H2,1-4H3,(H2,38,43)(H,40,44)/t33-,34+/m0/s1 |
| InChIKey | VZKXPIBGZVEAGT-SZAHLOSFSA-N |
| XLogP | 4.96 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|