C34H41F3N4O5 — CID 68611631
1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 68611631) has the molecular formula C34H41F3N4O5 and a molecular weight of 642.72 g/mol. Its IUPAC name is 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 68611631 |
| Molecular Formula | C34H41F3N4O5 |
| Molecular Weight | 642.72 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-[3-(trifluoromethyl)phenyl]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](Cc2cccc(C(F)(F)F)c2)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C34H41F3N4O5/c1-4-12-41(13-5-2)33(45)26-18-24(31(38)43)17-25(19-26)32(44)40-29(16-22-8-6-10-27(14-22)34(35,36)37)30(42)21-39-20-23-9-7-11-28(15-23)46-3/h6-11,14-15,17-19,29-30,39,42H,4-5,12-13,16,20-21H2,1-3H3,(H2,38,43)(H,40,44)/t29-,30+/m0/s1 |
| InChIKey | PTZIQKSAEVVDDU-XZWHSSHBSA-N |
| XLogP | 4.57 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |