C33H39F4N3O4 — CID 87825207
1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(2,3,5,6-tetrafluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 87825207) has the molecular formula C33H39F4N3O4 and a molecular weight of 617.68 g/mol. Its IUPAC name is 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(2,3,5,6-tetrafluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(2,3,5,6-tetrafluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87825207 |
| Molecular Formula | C33H39F4N3O4 |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 1-N-[(2S,3R)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]-1-(2,3,5,6-tetrafluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2c(F)c(F)cc(F)c2F)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C33H39F4N3O4/c1-5-10-40(11-6-2)33(43)23-13-20(3)12-22(15-23)32(42)39-28(16-25-30(36)26(34)17-27(35)31(25)37)29(41)19-38-18-21-8-7-9-24(14-21)44-4/h7-9,12-15,17,28-29,38,41H,5-6,10-11,16,18-19H2,1-4H3,(H,39,42)/t28-,29+/m0/s1 |
| InChIKey | MXTMJEILHKNHSD-URLMMPGGSA-N |
| XLogP | 5.31 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|