C33H37F6N3O3 — CID 87592827
1-N-[(2S,3R)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]-1-(3,4,5-trifluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 87592827) has the molecular formula C33H37F6N3O3 and a molecular weight of 637.67 g/mol. Its IUPAC name is 1-N-[(2S,3R)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]-1-(3,4,5-trifluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]-1-(3,4,5-trifluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87592827 |
| Molecular Formula | C33H37F6N3O3 |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.27 |
| IUPAC Name | 1-N-[(2S,3R)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methylamino]-1-(3,4,5-trifluorophenyl)butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)c(F)c(F)c2)[C@H](O)CNCc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C33H37F6N3O3/c1-4-9-42(10-5-2)32(45)24-12-20(3)11-23(17-24)31(44)41-28(16-22-14-26(34)30(36)27(35)15-22)29(43)19-40-18-21-7-6-8-25(13-21)33(37,38)39/h6-8,11-15,17,28-29,40,43H,4-5,9-10,16,18-19H2,1-3H3,(H,41,44)/t28-,29+/m0/s1 |
| InChIKey | ATZLBNGALPWGET-URLMMPGGSA-N |
| XLogP | 6.19 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|