C34H43N3O6 — CID 68609920
1-N-[(2S,3R)-1-(1,3-benzodioxol-5-yl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68609920) has the molecular formula C34H43N3O6 and a molecular weight of 589.73 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(1,3-benzodioxol-5-yl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(1,3-benzodioxol-5-yl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68609920 |
| Molecular Formula | C34H43N3O6 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.32 |
| IUPAC Name | 1-N-[(2S,3R)-1-(1,3-benzodioxol-5-yl)-3-hydroxy-4-[(3-methoxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2ccc3c(c2)OCO3)[C@H](O)CNCc2cccc(OC)c2)c1 |
| InChI | InChI=1S/C34H43N3O6/c1-5-12-37(13-6-2)34(40)27-15-23(3)14-26(19-27)33(39)36-29(17-24-10-11-31-32(18-24)43-22-42-31)30(38)21-35-20-25-8-7-9-28(16-25)41-4/h7-11,14-16,18-19,29-30,35,38H,5-6,12-13,17,20-22H2,1-4H3,(H,36,39)/t29-,30+/m0/s1 |
| InChIKey | LMYNIEUEBCAZDQ-XZWHSSHBSA-N |
| XLogP | 4.49 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |